C23H37ClO3 — CID 58319509
(Z)-8-[(1R,2R,3R,5R)-5-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]oct-6-en-2-one (PubChem CID 58319509) has the molecular formula C23H37ClO3 and a molecular weight of 397.00 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,3R,5R)-5-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]oct-6-en-2-one.
| Compound Name | (Z)-8-[(1R,2R,3R,5R)-5-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 58319509 |
| Molecular Formula | C23H37ClO3 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (Z)-8-[(1R,2R,3R,5R)-5-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]oct-6-en-2-one |
| SMILES | CCC1(C(O)C/C=C/[C@@H]2[C@@H](C/C=C\CCCC(C)=O)[C@H](Cl)C[C@H]2O)CCC1 |
| InChI | InChI=1S/C23H37ClO3/c1-3-23(14-9-15-23)22(27)13-8-12-19-18(20(24)16-21(19)26)11-7-5-4-6-10-17(2)25/h5,7-8,12,18-22,26-27H,3-4,6,9-11,13-16H2,1-2H3/b7-5-,12-8+/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | BTOSKRWZDRCOHM-PXSWYXSISA-N |
| XLogP | 5.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|