C21H33ClO4 — CID 70272225
(Z)-7-[(1R,2R,3R,5S)-5-chloro-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70272225) has the molecular formula C21H33ClO4 and a molecular weight of 384.94 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-5-chloro-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-5-chloro-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70272225 |
| Molecular Formula | C21H33ClO4 |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-5-chloro-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CC1(C(O)C/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@@H](Cl)C[C@H]2O)CCC1 |
| InChI | InChI=1S/C21H33ClO4/c1-21(12-7-13-21)19(24)10-6-9-16-15(17(22)14-18(16)23)8-4-2-3-5-11-20(25)26/h2,4,6,9,15-19,23-24H,3,5,7-8,10-14H2,1H3,(H,25,26)/b4-2-,9-6+/t15-,16-,17+,18-,19?/m1/s1 |
| InChIKey | RPJNLEDONDZDKT-PTWFVOACSA-N |
| XLogP | 4.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|