C21H35ClO5 — CID 143845917
(Z)-7-[(1R,3R)-5-chloro-3-hydroxy-2-[(E,3S)-3-hydroxy-7-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 143845917) has the molecular formula C21H35ClO5 and a molecular weight of 402.96 g/mol. Its IUPAC name is (Z)-7-[(1R,3R)-5-chloro-3-hydroxy-2-[(E,3S)-3-hydroxy-7-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3R)-5-chloro-3-hydroxy-2-[(E,3S)-3-hydroxy-7-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 143845917 |
| Molecular Formula | C21H35ClO5 |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (Z)-7-[(1R,3R)-5-chloro-3-hydroxy-2-[(E,3S)-3-hydroxy-7-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | COC(C)CCC[C@H](O)/C=C/C1[C@@H](C/C=C\CCCC(=O)O)C(Cl)C[C@H]1O |
| InChI | InChI=1S/C21H35ClO5/c1-15(27-2)8-7-9-16(23)12-13-18-17(19(22)14-20(18)24)10-5-3-4-6-11-21(25)26/h3,5,12-13,15-20,23-24H,4,6-11,14H2,1-2H3,(H,25,26)/b5-3-,13-12+/t15?,16-,17+,18?,19?,20+/m0/s1 |
| InChIKey | ARNQTENKLXPLOK-IHMTWBLKSA-N |
| XLogP | 3.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|