C22H38BrClO4 — CID 143845916
bromomethane;(Z)-7-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-methylcyclopentyl]hept-5-enoic acid (PubChem CID 143845916) has the molecular formula C22H38BrClO4 and a molecular weight of 481.90 g/mol. Its IUPAC name is bromomethane;(Z)-7-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | bromomethane;(Z)-7-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 143845916 |
| Molecular Formula | C22H38BrClO4 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | bromomethane;(Z)-7-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CBr.CC(O)CCC[C@H](O)/C=C/C1[C@@H](C/C=C\CCCC(=O)O)C(Cl)C[C@H]1C |
| InChI | InChI=1S/C21H35ClO4.CH3Br/c1-15-14-20(22)19(10-5-3-4-6-11-21(25)26)18(15)13-12-17(24)9-7-8-16(2)23;1-2/h3,5,12-13,15-20,23-24H,4,6-11,14H2,1-2H3,(H,25,26);1H3/b5-3-,13-12+;/t15-,16?,17+,18?,19-,20?;/m1./s1 |
| InChIKey | DTFYFKJDRVGSFY-HDYDMYARSA-N |
| XLogP | 5.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|