C21H35FO5 — CID 91362064
7-[(1R,2R,3R,5R)-2-[(8S)-3,8-dihydroxynon-1-enyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91362064) has the molecular formula C21H35FO5 and a molecular weight of 386.50 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-2-[(8S)-3,8-dihydroxynon-1-enyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-2-[(8S)-3,8-dihydroxynon-1-enyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91362064 |
| Molecular Formula | C21H35FO5 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-2-[(8S)-3,8-dihydroxynon-1-enyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | C[C@H](O)CCCCC(O)C=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@H](F)C[C@H]1O |
| InChI | InChI=1S/C21H35FO5/c1-15(23)8-6-7-9-16(24)12-13-18-17(19(22)14-20(18)25)10-4-2-3-5-11-21(26)27/h2,4,12-13,15-20,23-25H,3,5-11,14H2,1H3,(H,26,27)/t15-,16?,17+,18+,19+,20+/m0/s1 |
| InChIKey | XQUSKQIYOMBESK-HNKURNSESA-N |
| XLogP | 3.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|