C20H33ClO5 — CID 67018006
7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67018006) has the molecular formula C20H33ClO5 and a molecular weight of 388.93 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67018006 |
| Molecular Formula | C20H33ClO5 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | C[C@@H](O)CCC[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C20H33ClO5/c1-14(22)7-6-8-15(23)11-12-17-16(18(21)13-19(17)24)9-4-2-3-5-10-20(25)26/h2,4,11-12,14-19,22-24H,3,5-10,13H2,1H3,(H,25,26)/t14-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | BXUHXMVABPDEHP-RWLNFDPSSA-N |
| XLogP | 3.26 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|