C25H41ClO6 — CID 68937871
(E)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 68937871) has the molecular formula C25H41ClO6 and a molecular weight of 473.05 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68937871 |
| Molecular Formula | C25H41ClO6 |
| Molecular Weight | 473.05 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (E)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | C[C@@H](O)CCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C/CCCC(=O)O)[C@H](Cl)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H41ClO6/c1-18(27)9-8-10-19(28)14-15-21-20(11-4-2-3-5-12-24(29)30)22(26)17-23(21)32-25-13-6-7-16-31-25/h2,4,14-15,18-23,25,27-28H,3,5-13,16-17H2,1H3,(H,29,30)/b4-2+,15-14+/t18-,19+,20-,21-,22-,23-,25?/m1/s1 |
| InChIKey | FVXSFUXJOVTEOC-HEUINKTGSA-N |
| XLogP | 4.81 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.05 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|