C27H45ClO5 — CID 68771117
(Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 68771117) has the molecular formula C27H45ClO5 and a molecular weight of 485.11 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68771117 |
| Molecular Formula | C27H45ClO5 |
| Molecular Weight | 485.11 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](Cl)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H45ClO5/c1-3-4-11-20(2)18-21(29)15-16-23-22(12-7-5-6-8-13-26(30)31)24(28)19-25(23)33-27-14-9-10-17-32-27/h5,7,15-16,20-25,27,29H,3-4,6,8-14,17-19H2,1-2H3,(H,30,31)/b7-5-,16-15+/t20-,21+,22+,23-,24-,25+,27?/m0/s1 |
| InChIKey | QOZACTCAEBLWDF-KCJOUPKHSA-N |
| XLogP | 6.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.11 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|