C27H42O5 — CID 70458816
(Z)-7-[(1S,5R)-5-[(E,3R,5R)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70458816) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (Z)-7-[(1S,5R)-5-[(E,3R,5R)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,5R)-5-[(E,3R,5R)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70458816 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (Z)-7-[(1S,5R)-5-[(E,3R,5R)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CCCC[C@@H](C)C[C@H](/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C27H42O5/c1-3-4-11-21(2)20-23(32-27-14-9-10-19-31-27)16-17-24-22(15-18-25(24)28)12-7-5-6-8-13-26(29)30/h5,7,15-18,21-24,27H,3-4,6,8-14,19-20H2,1-2H3,(H,29,30)/b7-5-,17-16+/t21-,22+,23+,24-,27?/m1/s1 |
| InChIKey | XGIRQKHLPXDCHP-PBKVDXSASA-N |
| XLogP | 6.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|