C40H60O8 — CID 70478991
[(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-2-[(E,3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate (PubChem CID 70478991) has the molecular formula C40H60O8 and a molecular weight of 668.91 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-2-[(E,3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-2-[(E,3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate |
|---|---|
| PubChem CID | 70478991 |
| Molecular Formula | C40H60O8 |
| Molecular Weight | 668.91 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-2-[(E,3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](OC2CCCCO2)C[C@H]1OC(=O)c1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C40H60O8/c1-4-5-17-30(2)28-32(46-38-22-13-15-26-44-38)24-25-34-33(20-11-6-7-12-21-37(41)43-3)35(47-39-23-14-16-27-45-39)29-36(34)48-40(42)31-18-9-8-10-19-31/h6,8-11,18-19,24-25,30,32-36,38-39H,4-5,7,12-17,20-23,26-29H2,1-3H3/b11-6-,25-24+/t30-,32+,33+,34+,35-,36+,38?,39?/m0/s1 |
| InChIKey | OQCLASYSOWCCMR-RQSUKHTGSA-N |
| XLogP | 8.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.91 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|