C33H50O8 — CID 14445350
methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-(oxan-2-yloxy)-2-[(E)-3-(oxan-2-yloxy)oct-1-en-5-ynyl]cyclopentyl]hept-5-enoate (PubChem CID 14445350) has the molecular formula C33H50O8 and a molecular weight of 574.76 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-(oxan-2-yloxy)-2-[(E)-3-(oxan-2-yloxy)oct-1-en-5-ynyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-(oxan-2-yloxy)-2-[(E)-3-(oxan-2-yloxy)oct-1-en-5-ynyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 14445350 |
| Molecular Formula | C33H50O8 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-(oxan-2-yloxy)-2-[(E)-3-(oxan-2-yloxy)oct-1-en-5-ynyl]cyclopentyl]hept-5-enoate |
| SMILES | CCC#CCC(/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C33H50O8/c1-4-5-8-15-26(40-32-18-11-13-22-37-32)20-21-28-27(16-9-6-7-10-17-31(35)36-3)29(39-25(2)34)24-30(28)41-33-19-12-14-23-38-33/h6,9,20-21,26-30,32-33H,4,7,10-19,22-24H2,1-3H3/b9-6-,21-20+/t26?,27-,28-,29+,30-,32?,33?/m1/s1 |
| InChIKey | NCARHZGPXQFVEL-OXAHPFBPSA-N |
| XLogP | 6.03 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|