C39H56O9S — CID 86738250
methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-(4-methylphenyl)sulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 86738250) has the molecular formula C39H56O9S and a molecular weight of 700.93 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-(4-methylphenyl)sulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-(4-methylphenyl)sulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 86738250 |
| Molecular Formula | C39H56O9S |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-(4-methylphenyl)sulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC#CCC(C)[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](OS(=O)(=O)c2ccc(C)cc2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C39H56O9S/c1-5-6-15-30(3)34(46-38-18-11-13-26-44-38)25-24-33-32(16-9-7-8-10-17-37(40)43-4)36(28-35(33)47-39-19-12-14-27-45-39)48-49(41,42)31-22-20-29(2)21-23-31/h7,9,20-25,30,32-36,38-39H,8,10-19,26-28H2,1-4H3/b9-7-,25-24+/t30?,32-,33-,34-,35-,36+,38?,39?/m1/s1 |
| InChIKey | TUYHUVFLFWBTKX-WZWGQETDSA-N |
| XLogP | 7.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|