C40H52O8 — CID 70480196
[(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl] benzoate (PubChem CID 70480196) has the molecular formula C40H52O8 and a molecular weight of 660.85 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 70480196 |
| Molecular Formula | C40H52O8 |
| Molecular Weight | 660.85 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | [(1R,2R,3R,4S)-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl] benzoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](Cc2ccccc2)OC2CCCCO2)[C@H](OC(=O)c2ccccc2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C40H52O8/c1-43-37(41)21-11-3-2-10-20-33-34(25-24-32(28-30-16-6-4-7-17-30)46-38-22-12-14-26-44-38)36(48-40(42)31-18-8-5-9-19-31)29-35(33)47-39-23-13-15-27-45-39/h2,4-10,16-19,24-25,32-36,38-39H,3,11-15,20-23,26-29H2,1H3/b10-2-,25-24+/t32-,33-,34-,35+,36-,38?,39?/m1/s1 |
| InChIKey | SZSCNDVTZBNFSA-UPUNHFFUSA-N |
| XLogP | 7.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.85 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|