C32H47NO7S — CID 86585190
methyl 7-[2-(benzylcarbamothioyloxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 86585190) has the molecular formula C32H47NO7S and a molecular weight of 589.80 g/mol. Its IUPAC name is methyl 7-[2-(benzylcarbamothioyloxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[2-(benzylcarbamothioyloxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 86585190 |
| Molecular Formula | C32H47NO7S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | methyl 7-[2-(benzylcarbamothioyloxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CCC1C(OC2CCCCO2)CC(OC2CCCCO2)C1COC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C32H47NO7S/c1-35-29(34)16-8-3-2-7-15-25-26(23-38-32(41)33-22-24-13-5-4-6-14-24)28(40-31-18-10-12-20-37-31)21-27(25)39-30-17-9-11-19-36-30/h2,4-7,13-14,25-28,30-31H,3,8-12,15-23H2,1H3,(H,33,41) |
| InChIKey | PUNMGTNGFINRLO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|