C37H57NO7 — CID 58657879
(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]cyclopentyl]-N-ethylhept-5-enamide (PubChem CID 58657879) has the molecular formula C37H57NO7 and a molecular weight of 627.86 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]cyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]cyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 58657879 |
| Molecular Formula | C37H57NO7 |
| Molecular Weight | 627.86 g/mol |
| Exact Mass | 627.41 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]cyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@@H](CCC2(CCc3ccccc3)OCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C37H57NO7/c1-2-38-34(39)17-9-4-3-8-16-30-31(21-23-37(42-26-27-43-37)22-20-29-14-6-5-7-15-29)33(45-36-19-11-13-25-41-36)28-32(30)44-35-18-10-12-24-40-35/h3,5-8,14-15,30-33,35-36H,2,4,9-13,16-28H2,1H3,(H,38,39)/b8-3-/t30-,31-,32+,33-,35?,36?/m1/s1 |
| InChIKey | PWKFLPORHFMACF-RBMCDUCXSA-N |
| XLogP | 6.85 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.86 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|