C42H54O7Si — CID 67797043
[(1R,2S,3R,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate (PubChem CID 67797043) has the molecular formula C42H54O7Si and a molecular weight of 698.97 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate.
| Compound Name | [(1R,2S,3R,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate |
|---|---|
| PubChem CID | 67797043 |
| Molecular Formula | C42H54O7Si |
| Molecular Weight | 698.97 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | [(1R,2S,3R,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-(oxan-2-yloxy)cyclopentyl] benzoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OC2CCCCO2)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H54O7Si/c1-42(2,3)50(33-22-12-8-13-23-33,34-24-14-9-15-25-34)47-31-36-35(26-16-5-6-17-27-39(43)45-4)37(49-41(44)32-20-10-7-11-21-32)30-38(36)48-40-28-18-19-29-46-40/h5,7-16,20-25,35-38,40H,6,17-19,26-31H2,1-4H3/b16-5-/t35-,36-,37+,38+,40?/m0/s1 |
| InChIKey | PEOLNXDXIAJPBZ-JDXPUEEESA-N |
| XLogP | 7.63 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.97 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|