C36H46O4Si — CID 67796464
methyl (Z)-7-[(1S,2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-phenylcyclopentyl]hept-5-enoate (PubChem CID 67796464) has the molecular formula C36H46O4Si and a molecular weight of 570.85 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-phenylcyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-phenylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67796464 |
| Molecular Formula | C36H46O4Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | methyl (Z)-7-[(1S,2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-phenylcyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C36H46O4Si/c1-36(2,3)41(29-20-12-8-13-21-29,30-22-14-9-15-23-30)40-27-33-31(24-16-5-6-17-25-35(38)39-4)34(37)26-32(33)28-18-10-7-11-19-28/h5,7-16,18-23,31-34,37H,6,17,24-27H2,1-4H3/b16-5-/t31-,32?,33-,34-/m0/s1 |
| InChIKey | YRAJGDPPPHAQQA-UORBLWLMSA-N |
| XLogP | 6.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|