C22H31NO6 — CID 22613238
methyl (E)-7-[2-(benzylcarbamoyloxymethyl)-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 22613238) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is methyl (E)-7-[2-(benzylcarbamoyloxymethyl)-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[2-(benzylcarbamoyloxymethyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 22613238 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | methyl (E)-7-[2-(benzylcarbamoyloxymethyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C/CC1C(O)CC(O)C1COC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H31NO6/c1-28-21(26)12-8-3-2-7-11-17-18(20(25)13-19(17)24)15-29-22(27)23-14-16-9-5-4-6-10-16/h2,4-7,9-10,17-20,24-25H,3,8,11-15H2,1H3,(H,23,27)/b7-2+ |
| InChIKey | LFFNSAGQKMGKTE-FARCUNLSSA-N |
| XLogP | 2.56 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|