C23H33ClN2O5S — CID 90720309
O-[[(1S,2R)-3,5-dihydroxy-2-[7-(2-hydroxyethylamino)-7-oxohept-2-enyl]cyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate (PubChem CID 90720309) has the molecular formula C23H33ClN2O5S and a molecular weight of 485.05 g/mol. Its IUPAC name is O-[[(1S,2R)-3,5-dihydroxy-2-[7-(2-hydroxyethylamino)-7-oxohept-2-enyl]cyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate.
| Compound Name | O-[[(1S,2R)-3,5-dihydroxy-2-[7-(2-hydroxyethylamino)-7-oxohept-2-enyl]cyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate |
|---|---|
| PubChem CID | 90720309 |
| Molecular Formula | C23H33ClN2O5S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | O-[[(1S,2R)-3,5-dihydroxy-2-[7-(2-hydroxyethylamino)-7-oxohept-2-enyl]cyclopentyl]methyl] N-[(3-chlorophenyl)methyl]carbamothioate |
| SMILES | O=C(CCCC=CC[C@H]1C(O)CC(O)[C@@H]1COC(=S)NCc1cccc(Cl)c1)NCCO |
| InChI | InChI=1S/C23H33ClN2O5S/c24-17-7-5-6-16(12-17)14-26-23(32)31-15-19-18(20(28)13-21(19)29)8-3-1-2-4-9-22(30)25-10-11-27/h1,3,5-7,12,18-21,27-29H,2,4,8-11,13-15H2,(H,25,30)(H,26,32)/t18-,19-,20?,21?/m1/s1 |
| InChIKey | RQVWSFJBBOXNIF-HJLBWTBNSA-N |
| XLogP | 2.31 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|