C20H26Cl2O5 — CID 67211702
7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(hydroxymethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67211702) has the molecular formula C20H26Cl2O5 and a molecular weight of 417.33 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(hydroxymethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(hydroxymethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67211702 |
| Molecular Formula | C20H26Cl2O5 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(hydroxymethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](COc2cc(Cl)cc(CO)c2)[C@H](O)C[C@@H]1Cl |
| InChI | InChI=1S/C20H26Cl2O5/c21-14-7-13(11-23)8-15(9-14)27-12-17-16(18(22)10-19(17)24)5-3-1-2-4-6-20(25)26/h1,3,7-9,16-19,23-24H,2,4-6,10-12H2,(H,25,26)/t16-,17-,18+,19-/m1/s1 |
| InChIKey | HIPNJDTUNPWFCM-AKHDSKFASA-N |
| XLogP | 4.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|