C19H25ClO5 — CID 24983623
(Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[(3-hydroxyphenoxy)methyl]cyclopentyl]hept-5-enoic acid (PubChem CID 24983623) has the molecular formula C19H25ClO5 and a molecular weight of 368.86 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[(3-hydroxyphenoxy)methyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[(3-hydroxyphenoxy)methyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 24983623 |
| Molecular Formula | C19H25ClO5 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[(3-hydroxyphenoxy)methyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](COc2cccc(O)c2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C19H25ClO5/c20-17-11-18(22)16(12-25-14-7-5-6-13(21)10-14)15(17)8-3-1-2-4-9-19(23)24/h1,3,5-7,10,15-18,21-22H,2,4,8-9,11-12H2,(H,23,24)/b3-1-/t15-,16-,17-,18-/m1/s1 |
| InChIKey | LPUCZWRJECVVJZ-ZUIALZHFSA-N |
| XLogP | 3.58 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|