C21H23ClF6O4 — CID 87432770
(Z)-7-[(1R,2S,3R,5S)-2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-5-chloro-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 87432770) has the molecular formula C21H23ClF6O4 and a molecular weight of 488.85 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5S)-2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-5-chloro-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5S)-2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-5-chloro-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 87432770 |
| Molecular Formula | C21H23ClF6O4 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5S)-2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-5-chloro-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](O)C[C@@H]1Cl |
| InChI | InChI=1S/C21H23ClF6O4/c22-17-10-18(29)16(15(17)5-3-1-2-4-6-19(30)31)11-32-14-8-12(20(23,24)25)7-13(9-14)21(26,27)28/h1,3,7-9,15-18,29H,2,4-6,10-11H2,(H,30,31)/b3-1-/t15-,16-,17+,18-/m1/s1 |
| InChIKey | KHOILFVUJGEFIZ-WBIFQALJSA-N |
| XLogP | 5.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|