C22H29Cl3O4 — CID 89272224
(Z)-10-[(1R,2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]-1-hydroxydec-8-en-4-one (PubChem CID 89272224) has the molecular formula C22H29Cl3O4 and a molecular weight of 463.83 g/mol. Its IUPAC name is (Z)-10-[(1R,2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]-1-hydroxydec-8-en-4-one.
| Compound Name | (Z)-10-[(1R,2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]-1-hydroxydec-8-en-4-one |
|---|---|
| PubChem CID | 89272224 |
| Molecular Formula | C22H29Cl3O4 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (Z)-10-[(1R,2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]-1-hydroxydec-8-en-4-one |
| SMILES | O=C(CCCO)CCC/C=C\C[C@@H]1[C@@H](COc2cc(Cl)cc(Cl)c2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C22H29Cl3O4/c23-15-10-16(24)12-18(11-15)29-14-20-19(21(25)13-22(20)28)8-4-2-1-3-6-17(27)7-5-9-26/h2,4,10-12,19-22,26,28H,1,3,5-9,13-14H2/b4-2-/t19-,20-,21-,22-/m1/s1 |
| InChIKey | DZFMTKYJDVFIPX-DKTPSRJTSA-N |
| XLogP | 5.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|