C21H29ClO4 — CID 67527560
(Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(3,5-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67527560) has the molecular formula C21H29ClO4 and a molecular weight of 380.91 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(3,5-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(3,5-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67527560 |
| Molecular Formula | C21H29ClO4 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[(3,5-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cc(C)cc(OC[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@@H](Cl)C[C@H]2O)c1 |
| InChI | InChI=1S/C21H29ClO4/c1-14-9-15(2)11-16(10-14)26-13-18-17(19(22)12-20(18)23)7-5-3-4-6-8-21(24)25/h3,5,9-11,17-20,23H,4,6-8,12-13H2,1-2H3,(H,24,25)/b5-3-/t17-,18-,19+,20-/m1/s1 |
| InChIKey | MFLCAZXUMAGVEO-GGJVOEJNSA-N |
| XLogP | 4.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|