C23H26Cl2O4 — CID 67529087
(Z)-7-[(1R,2S,3R)-5-chloro-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67529087) has the molecular formula C23H26Cl2O4 and a molecular weight of 437.36 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R)-5-chloro-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R)-5-chloro-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67529087 |
| Molecular Formula | C23H26Cl2O4 |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (Z)-7-[(1R,2S,3R)-5-chloro-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(Cl)C[C@@H](O)[C@@H]1COc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C23H26Cl2O4/c24-19-11-12-22(17-9-6-5-8-15(17)19)29-14-18-16(20(25)13-21(18)26)7-3-1-2-4-10-23(27)28/h1,3,5-6,8-9,11-12,16,18,20-21,26H,2,4,7,10,13-14H2,(H,27,28)/b3-1-/t16-,18-,20?,21-/m1/s1 |
| InChIKey | KZJOEZAMKVUPAU-XSDCWHGWSA-N |
| XLogP | 5.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|