C21H29ClO5 — CID 67527448
7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[2-(2-hydroxyethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67527448) has the molecular formula C21H29ClO5 and a molecular weight of 396.91 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[2-(2-hydroxyethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[2-(2-hydroxyethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67527448 |
| Molecular Formula | C21H29ClO5 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[2-(2-hydroxyethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](COc2ccccc2CCO)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C21H29ClO5/c22-18-13-19(24)17(16(18)8-3-1-2-4-10-21(25)26)14-27-20-9-6-5-7-15(20)11-12-23/h1,3,5-7,9,16-19,23-24H,2,4,8,10-14H2,(H,25,26)/t16-,17-,18-,19-/m1/s1 |
| InChIKey | BUGIQLLQSZAHKH-NCXUSEDFSA-N |
| XLogP | 3.41 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|