C23H33ClO5 — CID 24996124
(Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(1-hydroxy-2-methylpropyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid (PubChem CID 24996124) has the molecular formula C23H33ClO5 and a molecular weight of 424.97 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(1-hydroxy-2-methylpropyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(1-hydroxy-2-methylpropyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 24996124 |
| Molecular Formula | C23H33ClO5 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(1-hydroxy-2-methylpropyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)C(O)c1cccc(OC[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@H](Cl)C[C@H]2O)c1 |
| InChI | InChI=1S/C23H33ClO5/c1-15(2)23(28)16-8-7-9-17(12-16)29-14-19-18(20(24)13-21(19)25)10-5-3-4-6-11-22(26)27/h3,5,7-9,12,15,18-21,23,25,28H,4,6,10-11,13-14H2,1-2H3,(H,26,27)/b5-3-/t18-,19-,20-,21-,23?/m1/s1 |
| InChIKey | HJNSQACCCKECFL-XOBHXIHBSA-N |
| XLogP | 4.56 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|