C26H32ClO3Y- — CID 58378647
(1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[3-(1-hydroxy-2-phenylethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium (PubChem CID 58378647) has the molecular formula C26H32ClO3Y- and a molecular weight of 516.90 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[3-(1-hydroxy-2-phenylethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium.
| Compound Name | (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[3-(1-hydroxy-2-phenylethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium |
|---|---|
| PubChem CID | 58378647 |
| Molecular Formula | C26H32ClO3Y- |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[3-(1-hydroxy-2-phenylethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium |
| SMILES | [CH2-]CC/C=C\C[C@@H]1[C@@H](COc2cccc(C(O)Cc3ccccc3)c2)[C@H](O)C[C@H]1Cl.[Y] |
| InChI | InChI=1S/C26H32ClO3.Y/c1-2-3-4-8-14-22-23(26(29)17-24(22)27)18-30-21-13-9-12-20(16-21)25(28)15-19-10-6-5-7-11-19;/h4-13,16,22-26,28-29H,1-3,14-15,17-18H2;/q-1;/b8-4-;/t22-,23-,24-,25?,26-;/m1./s1 |
| InChIKey | ITFWZKKYDCUMIZ-PHOJHGSCSA-N |
| XLogP | 5.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|