C20H28ClO3Y- — CID 58378700
(1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[4-(1-hydroxyethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium (PubChem CID 58378700) has the molecular formula C20H28ClO3Y- and a molecular weight of 440.80 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[4-(1-hydroxyethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium.
| Compound Name | (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[4-(1-hydroxyethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium |
|---|---|
| PubChem CID | 58378700 |
| Molecular Formula | C20H28ClO3Y- |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (1R,2S,3R,4R)-4-chloro-3-[(Z)-hex-2-enyl]-2-[[4-(1-hydroxyethyl)phenoxy]methyl]cyclopentan-1-ol;yttrium |
| SMILES | [CH2-]CC/C=C\C[C@@H]1[C@@H](COc2ccc(C(C)O)cc2)[C@H](O)C[C@H]1Cl.[Y] |
| InChI | InChI=1S/C20H28ClO3.Y/c1-3-4-5-6-7-17-18(20(23)12-19(17)21)13-24-16-10-8-15(9-11-16)14(2)22;/h5-6,8-11,14,17-20,22-23H,1,3-4,7,12-13H2,2H3;/q-1;/b6-5-;/t14?,17-,18-,19-,20-;/m1./s1 |
| InChIKey | PYLKZFVZFHZUKC-MVYZGTTHSA-N |
| XLogP | 4.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|