C17H18O3 — CID 66364563
1-[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]ethanol (PubChem CID 66364563) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]ethanol.
| Compound Name | 1-[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 66364563 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]ethanol |
| SMILES | CC(O)c1ccc(OCC2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C17H18O3/c1-12(18)13-6-8-15(9-7-13)19-11-16-10-14-4-2-3-5-17(14)20-16/h2-9,12,16,18H,10-11H2,1H3 |
| InChIKey | RBHFKXRCNKNSAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |