C10H12O4S — CID 11195526
[(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate (PubChem CID 11195526) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate.
| Compound Name | [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11195526 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C10H12O4S/c1-15(11,12)13-7-9-6-8-4-2-3-5-10(8)14-9/h2-5,9H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | NTZWKANUHMRDCQ-SECBINFHSA-N |
| XLogP | 0.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|