About 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran
2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran (PubChem CID 12872573) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran.
Analyze 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran (CID 12872573) is 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran is CSCC1Cc2ccccc2O1.
What is the InChIKey of 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran?
The InChIKey is KLILPDVVTZYTRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-12-7-9-6-8-4-2-3-5-10(8)11-9/h2-5,9H,6-7H2,1H3.
What are the key properties of 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran?
2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran has a molecular weight of 180.27 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylsulfanylmethyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 12872573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).