C12H14O — CID 102067628
2-[(E)-but-2-enyl]-2,3-dihydro-1-benzofuran (PubChem CID 102067628) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[(E)-but-2-enyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 102067628 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-[(E)-but-2-enyl]-2,3-dihydro-1-benzofuran |
| SMILES | C/C=C/CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H14O/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h2-6,8,11H,7,9H2,1H3/b3-2+ |
| InChIKey | KOQGKQZLNNXINI-NSCUHMNNSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|