C12H18NO+ — CID 3112651
2,3-dihydro-1-benzofuran-2-ylmethyl(trimethyl)azanium (PubChem CID 3112651) has the molecular formula C12H18NO+ and a molecular weight of 192.28 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-2-ylmethyl(trimethyl)azanium.
| Compound Name | 2,3-dihydro-1-benzofuran-2-ylmethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 3112651 |
| Molecular Formula | C12H18NO+ |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-2-ylmethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H18NO/c1-13(2,3)9-11-8-10-6-4-5-7-12(10)14-11/h4-7,11H,8-9H2,1-3H3/q+1 |
| InChIKey | KLMPONMSMRLMOL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|