C11H15NO — CID 70261253
N-ethyl-N-methyl-2,3-dihydro-1-benzofuran-2-amine (PubChem CID 70261253) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydro-1-benzofuran-2-amine.
| Compound Name | N-ethyl-N-methyl-2,3-dihydro-1-benzofuran-2-amine |
|---|---|
| PubChem CID | 70261253 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydro-1-benzofuran-2-amine |
| SMILES | CCN(C)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C11H15NO/c1-3-12(2)11-8-9-6-4-5-7-10(9)13-11/h4-7,11H,3,8H2,1-2H3 |
| InChIKey | GREHFZVFSHEAEN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |