C12H17NO — CID 51885405
N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine (PubChem CID 51885405) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 51885405 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine |
| SMILES | CCCNC[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H17NO/c1-2-7-13-9-11-8-10-5-3-4-6-12(10)14-11/h3-6,11,13H,2,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | QWKVGBXXBFHXEK-NSHDSACASA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|