C16H24ClNO — CID 106286562
2-chloro-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylpentan-1-amine (PubChem CID 106286562) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylpentan-1-amine.
| Compound Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylpentan-1-amine |
|---|---|
| PubChem CID | 106286562 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylpentan-1-amine |
| SMILES | CCC(CC)C(Cl)CNCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H24ClNO/c1-3-12(4-2)15(17)11-18-10-14-9-13-7-5-6-8-16(13)19-14/h5-8,12,14-15,18H,3-4,9-11H2,1-2H3 |
| InChIKey | JJQVOTDRGFYRSQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|