C11H14INO — CID 114505487
N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-iodoethanamine (PubChem CID 114505487) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-iodoethanamine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-iodoethanamine |
|---|---|
| PubChem CID | 114505487 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-iodoethanamine |
| SMILES | ICCNCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C11H14INO/c12-5-6-13-8-10-7-9-3-1-2-4-11(9)14-10/h1-4,10,13H,5-8H2 |
| InChIKey | KABABISCXDAZGT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|