C14H17NO — CID 104806388
N-(2,3-dihydro-1-benzofuran-2-ylmethyl)pent-3-yn-1-amine (PubChem CID 104806388) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-2-ylmethyl)pent-3-yn-1-amine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)pent-3-yn-1-amine |
|---|---|
| PubChem CID | 104806388 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)pent-3-yn-1-amine |
| SMILES | CC#CCCNCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-6-9-15-11-13-10-12-7-4-5-8-14(12)16-13/h4-5,7-8,13,15H,6,9-11H2,1H3 |
| InChIKey | KBVYZDLSFKTSEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|