C12H16BrNO — CID 66393927
N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-1-amine (PubChem CID 66393927) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66393927 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C12H16BrNO/c1-2-5-14-8-11-7-9-6-10(13)3-4-12(9)15-11/h3-4,6,11,14H,2,5,7-8H2,1H3 |
| InChIKey | WZOQWHWDARXOFU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|