C11H14BrNO2 — CID 66392429
1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)-N-ethoxymethanamine (PubChem CID 66392429) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)-N-ethoxymethanamine.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)-N-ethoxymethanamine |
|---|---|
| PubChem CID | 66392429 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-2-yl)-N-ethoxymethanamine |
| SMILES | CCONCC1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C11H14BrNO2/c1-2-14-13-7-10-6-8-5-9(12)3-4-11(8)15-10/h3-5,10,13H,2,6-7H2,1H3 |
| InChIKey | CWVRLVDMEBXSTF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|