C9H9BrO2 — CID 86326706
[(2R)-5-bromo-2,3-dihydro-1-benzofuran-2-yl]methanol (PubChem CID 86326706) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is [(2R)-5-bromo-2,3-dihydro-1-benzofuran-2-yl]methanol.
| Compound Name | [(2R)-5-bromo-2,3-dihydro-1-benzofuran-2-yl]methanol |
|---|---|
| PubChem CID | 86326706 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | [(2R)-5-bromo-2,3-dihydro-1-benzofuran-2-yl]methanol |
| SMILES | OC[C@H]1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C9H9BrO2/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-3,8,11H,4-5H2/t8-/m1/s1 |
| InChIKey | COPLPYBSTHRUPU-MRVPVSSYSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |