C14H20BrO2Si — CID 174092443
CID 174092443 (PubChem CID 174092443) has the molecular formula C14H20BrO2Si and a molecular weight of 328.30 g/mol.
| Compound Name | CID 174092443 |
|---|---|
| PubChem CID | 174092443 |
| Molecular Formula | C14H20BrO2Si |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | — |
| SMILES | C[Si](OCC1Cc2cc(Br)ccc2O1)C(C)(C)C |
| InChI | InChI=1S/C14H20BrO2Si/c1-14(2,3)18(4)16-9-12-8-10-7-11(15)5-6-13(10)17-12/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | WHHPTEJVFDZRDS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|