C14H20BrNOS — CID 114248121
N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-ethylsulfanylpropan-1-amine (PubChem CID 114248121) has the molecular formula C14H20BrNOS and a molecular weight of 330.29 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-ethylsulfanylpropan-1-amine.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-ethylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 114248121 |
| Molecular Formula | C14H20BrNOS |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-ethylsulfanylpropan-1-amine |
| SMILES | CCSCCCNCC1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C14H20BrNOS/c1-2-18-7-3-6-16-10-13-9-11-8-12(15)4-5-14(11)17-13/h4-5,8,13,16H,2-3,6-7,9-10H2,1H3 |
| InChIKey | WYBGPFZVAKFASN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|