C11H14O2 — CID 130824833
(2-methyl-3,4-dihydro-2H-chromen-3-yl)methanol (PubChem CID 130824833) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-2H-chromen-3-yl)methanol.
| Compound Name | (2-methyl-3,4-dihydro-2H-chromen-3-yl)methanol |
|---|---|
| PubChem CID | 130824833 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2-methyl-3,4-dihydro-2H-chromen-3-yl)methanol |
| SMILES | CC1Oc2ccccc2CC1CO |
| InChI | InChI=1S/C11H14O2/c1-8-10(7-12)6-9-4-2-3-5-11(9)13-8/h2-5,8,10,12H,6-7H2,1H3 |
| InChIKey | HDGKMDITLHQCGD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |