C12H16O2 — CID 168763034
(2S,3R)-2-propyl-3,4-dihydro-2H-chromen-3-ol (PubChem CID 168763034) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S,3R)-2-propyl-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (2S,3R)-2-propyl-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 168763034 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2S,3R)-2-propyl-3,4-dihydro-2H-chromen-3-ol |
| SMILES | CCC[C@@H]1Oc2ccccc2C[C@H]1O |
| InChI | InChI=1S/C12H16O2/c1-2-5-12-10(13)8-9-6-3-4-7-11(9)14-12/h3-4,6-7,10,12-13H,2,5,8H2,1H3/t10-,12+/m1/s1 |
| InChIKey | OGJGQIJSFGIPOB-PWSUYJOCSA-N |
| XLogP | 2.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |