C9H11ClO — CID 140983033
2-methyl-2,3-dihydro-1-benzofuran;hydrochloride (PubChem CID 140983033) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzofuran;hydrochloride.
| Compound Name | 2-methyl-2,3-dihydro-1-benzofuran;hydrochloride |
|---|---|
| PubChem CID | 140983033 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-methyl-2,3-dihydro-1-benzofuran;hydrochloride |
| SMILES | CC1Cc2ccccc2O1.Cl |
| InChI | InChI=1S/C9H10O.ClH/c1-7-6-8-4-2-3-5-9(8)10-7;/h2-5,7H,6H2,1H3;1H |
| InChIKey | PYDGADDDDMEDSZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |