C9H9BrO — CID 93279299
(2S)-5-bromo-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 93279299) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is (2S)-5-bromo-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | (2S)-5-bromo-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 93279299 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | (2S)-5-bromo-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | C[C@H]1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C9H9BrO/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6H,4H2,1H3/t6-/m0/s1 |
| InChIKey | FEPPMMHYULGHKP-LURJTMIESA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |