C15H26O — CID 145338242
2,5-dimethyl-2,3-dihydro-1-benzofuran;ethane;propane (PubChem CID 145338242) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 2,5-dimethyl-2,3-dihydro-1-benzofuran;ethane;propane.
| Compound Name | 2,5-dimethyl-2,3-dihydro-1-benzofuran;ethane;propane |
|---|---|
| PubChem CID | 145338242 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2,5-dimethyl-2,3-dihydro-1-benzofuran;ethane;propane |
| SMILES | CC.CCC.Cc1ccc2c(c1)CC(C)O2 |
| InChI | InChI=1S/C10H12O.C3H8.C2H6/c1-7-3-4-10-9(5-7)6-8(2)11-10;1-3-2;1-2/h3-5,8H,6H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | ASUGOSRLVWAICA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |