C15H20Br2O — CID 79455391
2-[2,2-bis(bromomethyl)butyl]-5-methyl-2,3-dihydro-1-benzofuran (PubChem CID 79455391) has the molecular formula C15H20Br2O and a molecular weight of 376.13 g/mol. Its IUPAC name is 2-[2,2-bis(bromomethyl)butyl]-5-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[2,2-bis(bromomethyl)butyl]-5-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79455391 |
| Molecular Formula | C15H20Br2O |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-[2,2-bis(bromomethyl)butyl]-5-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CCC(CBr)(CBr)CC1Cc2cc(C)ccc2O1 |
| InChI | InChI=1S/C15H20Br2O/c1-3-15(9-16,10-17)8-13-7-12-6-11(2)4-5-14(12)18-13/h4-6,13H,3,7-10H2,1-2H3 |
| InChIKey | VFEHZMFMSVXYLL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|